C22H22O10 — CID 18643928
3-[(1R,4S,6R)-5-(3-carboxyphenyl)-6-[(1R)-1,2-dihydroxyethyl]-1,3,4,6-tetrahydroxy-2-bicyclo[2.2.0]hexanyl]benzoic acid (PubChem CID 18643928) has the molecular formula C22H22O10 and a molecular weight of 446.41 g/mol. Its IUPAC name is 3-[(1R,4S,6R)-5-(3-carboxyphenyl)-6-[(1R)-1,2-dihydroxyethyl]-1,3,4,6-tetrahydroxy-2-bicyclo[2.2.0]hexanyl]benzoic acid.
| Compound Name | 3-[(1R,4S,6R)-5-(3-carboxyphenyl)-6-[(1R)-1,2-dihydroxyethyl]-1,3,4,6-tetrahydroxy-2-bicyclo[2.2.0]hexanyl]benzoic acid |
|---|---|
| PubChem CID | 18643928 |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-[(1R,4S,6R)-5-(3-carboxyphenyl)-6-[(1R)-1,2-dihydroxyethyl]-1,3,4,6-tetrahydroxy-2-bicyclo[2.2.0]hexanyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2C(O)[C@@]3(O)C(c4cccc(C(=O)O)c4)[C@@](O)([C@H](O)CO)[C@@]23O)c1 |
| InChI | InChI=1S/C22H22O10/c23-9-14(24)20(30)16(11-4-2-6-13(8-11)19(28)29)21(31)17(25)15(22(20,21)32)10-3-1-5-12(7-10)18(26)27/h1-8,14-17,23-25,30-32H,9H2,(H,26,27)(H,28,29)/t14-,15?,16?,17?,20+,21+,22+/m1/s1 |
| InChIKey | XMUMCRFQLWGAQL-BZJXSGKBSA-N |
| XLogP | -1.12 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |