C17H22N2 — CID 18644461
3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-5,6,7,8a-tetrahydro-1H-quinolin-8-imine (PubChem CID 18644461) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-5,6,7,8a-tetrahydro-1H-quinolin-8-imine.
| Compound Name | 3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-5,6,7,8a-tetrahydro-1H-quinolin-8-imine |
|---|---|
| PubChem CID | 18644461 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3-methyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-5,6,7,8a-tetrahydro-1H-quinolin-8-imine |
| SMILES | CC1=CNC2C(=C1)CCC/C2=N\C1=CC=C(C)CC1 |
| InChI | InChI=1S/C17H22N2/c1-12-6-8-15(9-7-12)19-16-5-3-4-14-10-13(2)11-18-17(14)16/h6,8,10-11,17-18H,3-5,7,9H2,1-2H3/b19-16+ |
| InChIKey | QAACCAIWJGBBTE-KNTRCKAVSA-N |
| XLogP | 4.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|