C34H49N3 — CID 18644684
1-hexyl-4-[4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]cyclohexane-1-carbonitrile (PubChem CID 18644684) has the molecular formula C34H49N3 and a molecular weight of 499.79 g/mol. Its IUPAC name is 1-hexyl-4-[4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]cyclohexane-1-carbonitrile.
| Compound Name | 1-hexyl-4-[4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18644684 |
| Molecular Formula | C34H49N3 |
| Molecular Weight | 499.79 g/mol |
| Exact Mass | 499.39 |
| IUPAC Name | 1-hexyl-4-[4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCCC1(C#N)CCC(c2ccc(-c3ncc(C4CCC(CCCCC)CC4)cn3)cc2)CC1 |
| InChI | InChI=1S/C34H49N3/c1-3-5-7-9-21-34(26-35)22-19-30(20-23-34)28-15-17-31(18-16-28)33-36-24-32(25-37-33)29-13-11-27(12-14-29)10-8-6-4-2/h15-18,24-25,27,29-30H,3-14,19-23H2,1-2H3 |
| InChIKey | PQWHUQJZFBDGKC-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.79 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|