C23H30N2O2S — CID 18645863
2-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2S)-2-(pyrrolidine-1-carbonyl)-4-sulfanylidenepyrrolidin-3-yl]ethanone (PubChem CID 18645863) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 2-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2S)-2-(pyrrolidine-1-carbonyl)-4-sulfanylidenepyrrolidin-3-yl]ethanone.
| Compound Name | 2-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2S)-2-(pyrrolidine-1-carbonyl)-4-sulfanylidenepyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 18645863 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2S)-2-(pyrrolidine-1-carbonyl)-4-sulfanylidenepyrrolidin-3-yl]ethanone |
| SMILES | Cc1cc(C)c2c(c1)CC(CC(=O)C1C(=S)CN[C@@H]1C(=O)N1CCCC1)CC2 |
| InChI | InChI=1S/C23H30N2O2S/c1-14-9-15(2)18-6-5-16(11-17(18)10-14)12-19(26)21-20(28)13-24-22(21)23(27)25-7-3-4-8-25/h9-10,16,21-22,24H,3-8,11-13H2,1-2H3/t16?,21?,22-/m0/s1 |
| InChIKey | XCGMOHPWWXSPBN-PZPSAWLHSA-N |
| XLogP | 2.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|