C17H20F3NO4 — CID 18645896
1-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(2,2,2-trifluoroethoxy)-3,4-dihydrochromen-4-yl]pyrrolidin-2-one (PubChem CID 18645896) has the molecular formula C17H20F3NO4 and a molecular weight of 359.34 g/mol. Its IUPAC name is 1-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(2,2,2-trifluoroethoxy)-3,4-dihydrochromen-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(2,2,2-trifluoroethoxy)-3,4-dihydrochromen-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 18645896 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(2,2,2-trifluoroethoxy)-3,4-dihydrochromen-4-yl]pyrrolidin-2-one |
| SMILES | CC1(C)Oc2ccc(OCC(F)(F)F)cc2[C@H](N2CCCC2=O)[C@H]1O |
| InChI | InChI=1S/C17H20F3NO4/c1-16(2)15(23)14(21-7-3-4-13(21)22)11-8-10(5-6-12(11)25-16)24-9-17(18,19)20/h5-6,8,14-15,23H,3-4,7,9H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | NJSPXPNFMLBLMM-LSDHHAIUSA-N |
| XLogP | 2.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |