C18H27NO4 — CID 18646598
tert-butyl N-[(2R,3R,4R)-3-hydroxy-4-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 18646598) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4R)-3-hydroxy-4-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4R)-3-hydroxy-4-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 18646598 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl N-[(2R,3R,4R)-3-hydroxy-4-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | CC(C)O[C@@H]1c2ccccc2C[C@@H](NC(=O)OC(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C18H27NO4/c1-11(2)22-16-13-9-7-6-8-12(13)10-14(15(16)20)19-17(21)23-18(3,4)5/h6-9,11,14-16,20H,10H2,1-5H3,(H,19,21)/t14-,15-,16-/m1/s1 |
| InChIKey | GHSHUIROXDUBPG-BZUAXINKSA-N |
| XLogP | 2.96 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |