C38H35N5O6 — CID 18646768
N-[9-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 18646768) has the molecular formula C38H35N5O6 and a molecular weight of 657.73 g/mol. Its IUPAC name is N-[9-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 18646768 |
| Molecular Formula | C38H35N5O6 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | N-[9-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(O)[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C38H35N5O6/c1-47-28-17-13-26(14-18-28)38(25-11-7-4-8-12-25,27-15-19-29(48-2)20-16-27)34(45)33-30(44)21-31(49-33)43-23-41-32-35(39-22-40-36(32)43)42-37(46)24-9-5-3-6-10-24/h3-20,22-23,30-31,33-34,44-45H,21H2,1-2H3,(H,39,40,42,46)/t30-,31+,33-,34?/m0/s1 |
| InChIKey | OKLGPXUOUXXPSD-JAYFOSLISA-N |
| XLogP | 5.14 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|