C19H30O4 — CID 18646905
4-[(4R,5R)-5-(4-hydroxyhepta-1,6-dien-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,6-dien-4-ol (PubChem CID 18646905) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-[(4R,5R)-5-(4-hydroxyhepta-1,6-dien-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[(4R,5R)-5-(4-hydroxyhepta-1,6-dien-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 18646905 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-[(4R,5R)-5-(4-hydroxyhepta-1,6-dien-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)[C@@H]1OC(C)(C)O[C@H]1C(O)(CC=C)CC=C |
| InChI | InChI=1S/C19H30O4/c1-7-11-18(20,12-8-2)15-16(23-17(5,6)22-15)19(21,13-9-3)14-10-4/h7-10,15-16,20-21H,1-4,11-14H2,5-6H3/t15-,16-/m1/s1 |
| InChIKey | UWTPWHYMRHNCQY-HZPDHXFCSA-N |
| XLogP | 3.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|