C31H10F20O4 — CID 18646906
[(4R,5R)-5-[hydroxy-bis(2,3,4,5,6-pentafluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 18646906) has the molecular formula C31H10F20O4 and a molecular weight of 826.38 g/mol. Its IUPAC name is [(4R,5R)-5-[hydroxy-bis(2,3,4,5,6-pentafluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | [(4R,5R)-5-[hydroxy-bis(2,3,4,5,6-pentafluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 18646906 |
| Molecular Formula | C31H10F20O4 |
| Molecular Weight | 826.38 g/mol |
| Exact Mass | 826.03 |
| IUPAC Name | [(4R,5R)-5-[hydroxy-bis(2,3,4,5,6-pentafluorophenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | CC1(C)O[C@@H](C(O)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)[C@H](C(O)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)O1 |
| InChI | InChI=1S/C31H10F20O4/c1-29(2)54-27(30(52,3-7(32)15(40)23(48)16(41)8(3)33)4-9(34)17(42)24(49)18(43)10(4)35)28(55-29)31(53,5-11(36)19(44)25(50)20(45)12(5)37)6-13(38)21(46)26(51)22(47)14(6)39/h27-28,52-53H,1-2H3/t27-,28-/m1/s1 |
| InChIKey | NETXPFXTIIOXQY-VSGBNLITSA-N |
| XLogP | 8.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.38 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|