C25H38O6S — CID 18647007
(3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(1-methylsulfanylcyclobutanecarbonyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 18647007) has the molecular formula C25H38O6S and a molecular weight of 466.64 g/mol. Its IUPAC name is (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(1-methylsulfanylcyclobutanecarbonyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(1-methylsulfanylcyclobutanecarbonyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 18647007 |
| Molecular Formula | C25H38O6S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(1-methylsulfanylcyclobutanecarbonyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CSC1(C(=O)O[C@H]2C[C@@H](C)C=C3C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@H]32)CCC1 |
| InChI | InChI=1S/C25H38O6S/c1-15-11-17-6-5-16(2)20(8-7-18(26)13-19(27)14-22(28)29)23(17)21(12-15)31-24(30)25(32-3)9-4-10-25/h5-6,11,15-16,18-21,23,26-27H,4,7-10,12-14H2,1-3H3,(H,28,29)/t15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | RGWNUBSWXAUFAB-HGQWONQESA-N |
| XLogP | 3.96 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |