C32H54O4Si — CID 18647009
[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 1-methylcyclopentane-1-carboxylate (PubChem CID 18647009) has the molecular formula C32H54O4Si and a molecular weight of 530.87 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 1-methylcyclopentane-1-carboxylate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 1-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 18647009 |
| Molecular Formula | C32H54O4Si |
| Molecular Weight | 530.87 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 1-methylcyclopentane-1-carboxylate |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@H](O[Si](C)(C)C(C)(C)C)CCO3)[C@H]2[C@@H](OC(=O)C2(C)CCCC2)C1 |
| InChI | InChI=1S/C32H54O4Si/c1-22-19-24-12-11-23(2)27(29(24)28(20-22)35-30(33)32(6)16-9-10-17-32)14-13-25-21-26(15-18-34-25)36-37(7,8)31(3,4)5/h11-12,19,22-23,25-29H,9-10,13-18,20-21H2,1-8H3/t22-,23-,25+,26+,27-,28-,29-/m0/s1 |
| InChIKey | FKVQESVHVGMCJP-RMABUEJVSA-N |
| XLogP | 8.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.87 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|