About [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate
[4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate (PubChem CID 18647472) has the molecular formula C29H35FN2O3
and a molecular weight of 478.61 g/mol. Its IUPAC name is [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate.
Molecular Properties
| Compound Name | [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate |
| PubChem CID | 18647472 |
| Molecular Formula | C29H35FN2O3 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate |
| SMILES | CCCCCCCCOc1cnc(-c2ccc(-c3ccc(OC(=O)C[C@@H](F)CC)cc3)cc2)nc1 |
| InChI | InChI=1S/C29H35FN2O3/c1-3-5-6-7-8-9-18-34-27-20-31-29(32-21-27)24-12-10-22(11-13-24)23-14-16-26(17-15-23)35-28(33)19-25(30)4-2/h10-17,20-21,25H,3-9,18-19H2,1-2H3/t25-/m0/s1 |
| InChIKey | SEWIBNNMUYDDGI-VWLOTQADSA-N |
| XLogP | 7.59 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate?
The IUPAC name of [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate (CID 18647472) is [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate.
What is the SMILES notation for [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate?
The canonical SMILES for [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate is CCCCCCCCOc1cnc(-c2ccc(-c3ccc(OC(=O)C[C@@H](F)CC)cc3)cc2)nc1.
What is the InChIKey of [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate?
The InChIKey is SEWIBNNMUYDDGI-VWLOTQADSA-N. The full InChI is InChI=1S/C29H35FN2O3/c1-3-5-6-7-8-9-18-34-27-20-31-29(32-21-27)24-12-10-22(11-13-24)23-14-16-26(17-15-23)35-28(33)19-25(30)4-2/h10-17,20-21,25H,3-9,18-19H2,1-2H3/t25-/m0/s1.
What are the key properties of [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate?
[4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate has a molecular weight of 478.61 g/mol, XLogP of 7.59, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(5-octoxypyrimidin-2-yl)phenyl]phenyl] (3S)-3-fluoropentanoate is sourced from PubChem (CID 18647472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).