C6H11NaO6S — CID 18647631
sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate (PubChem CID 18647631) has the molecular formula C6H11NaO6S and a molecular weight of 234.20 g/mol. Its IUPAC name is sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate.
| Compound Name | sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
|---|---|
| PubChem CID | 18647631 |
| Molecular Formula | C6H11NaO6S |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
| SMILES | O=C([S-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Na+] |
| InChI | InChI=1S/C6H12O6S.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | MYWRUZADNZVHBJ-JJKGCWMISA-M |
| XLogP | -6.50 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|