C17H36F2O7Si2 — CID 18647641
(3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-difluoro-3,4,5-trihydroxypentanoic acid (PubChem CID 18647641) has the molecular formula C17H36F2O7Si2 and a molecular weight of 446.64 g/mol. Its IUPAC name is (3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-difluoro-3,4,5-trihydroxypentanoic acid.
| Compound Name | (3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-difluoro-3,4,5-trihydroxypentanoic acid |
|---|---|
| PubChem CID | 18647641 |
| Molecular Formula | C17H36F2O7Si2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-difluoro-3,4,5-trihydroxypentanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(O)[C@@H](O)[C@](O)(O[Si](C)(C)C(C)(C)C)C(F)(F)C(=O)O |
| InChI | InChI=1S/C17H36F2O7Si2/c1-14(2,3)27(7,8)25-12(21)11(20)17(24,16(18,19)13(22)23)26-28(9,10)15(4,5)6/h11-12,20-21,24H,1-10H3,(H,22,23)/t11-,12?,17+/m1/s1 |
| InChIKey | GXIKNHADGMHKMI-AURTYUHDSA-N |
| XLogP | 3.12 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|