C29H38O7Si — CID 18647942
(3aS,6S,6aS)-6-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 18647942) has the molecular formula C29H38O7Si and a molecular weight of 526.70 g/mol. Its IUPAC name is (3aS,6S,6aS)-6-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aS,6S,6aS)-6-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 18647942 |
| Molecular Formula | C29H38O7Si |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (3aS,6S,6aS)-6-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]([C@@H]2OC(=O)[C@H]3OC(C)(C)O[C@@H]23)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H38O7Si/c1-27(2,3)37(19-14-10-8-11-15-19,20-16-12-9-13-17-20)31-18-21-22(34-28(4,5)33-21)23-24-25(26(30)32-23)36-29(6,7)35-24/h8-17,21-25H,18H2,1-7H3/t21-,22+,23-,24-,25-/m0/s1 |
| InChIKey | YPNAYMCHMMUOFD-YCXOGWGTSA-N |
| XLogP | 3.53 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|