About 2-ethylheptanoic acid
2-ethylheptanoic acid (PubChem CID 18648) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-ethylheptanoic acid.
Molecular Properties
| Compound Name | 2-ethylheptanoic acid |
| PubChem CID | 18648 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2-ethylheptanoic acid |
| SMILES | CCCCCC(CC)C(=O)O |
| InChI | InChI=1S/C9H18O2/c1-3-5-6-7-8(4-2)9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | DYWSVUBJGFTOQC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylheptanoic acid?
The IUPAC name of 2-ethylheptanoic acid (CID 18648) is 2-ethylheptanoic acid.
What is the SMILES notation for 2-ethylheptanoic acid?
The canonical SMILES for 2-ethylheptanoic acid is CCCCCC(CC)C(=O)O.
What is the InChIKey of 2-ethylheptanoic acid?
The InChIKey is DYWSVUBJGFTOQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-3-5-6-7-8(4-2)9(10)11/h8H,3-7H2,1-2H3,(H,10,11).
What are the key properties of 2-ethylheptanoic acid?
2-ethylheptanoic acid has a molecular weight of 158.24 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylheptanoic acid is sourced from PubChem (CID 18648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).