C14H15F3N2O2 — CID 18648125
N-[(4R)-2-oxoazepan-4-yl]-3-(trifluoromethyl)benzamide (PubChem CID 18648125) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is N-[(4R)-2-oxoazepan-4-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(4R)-2-oxoazepan-4-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18648125 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[(4R)-2-oxoazepan-4-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C1C[C@H](NC(=O)c2cccc(C(F)(F)F)c2)CCCN1 |
| InChI | InChI=1S/C14H15F3N2O2/c15-14(16,17)10-4-1-3-9(7-10)13(21)19-11-5-2-6-18-12(20)8-11/h1,3-4,7,11H,2,5-6,8H2,(H,18,20)(H,19,21)/t11-/m1/s1 |
| InChIKey | NSSSSCGGQFOPND-LLVKDONJSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |