C8H11NO2 — CID 18648424
(1R,5S,7S)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one (PubChem CID 18648424) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (1R,5S,7S)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one.
| Compound Name | (1R,5S,7S)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one |
|---|---|
| PubChem CID | 18648424 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (1R,5S,7S)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one |
| SMILES | O=C1NC[C@@]23CC[C@@H](C[C@H]12)O3 |
| InChI | InChI=1S/C8H11NO2/c10-7-6-3-5-1-2-8(6,11-5)4-9-7/h5-6H,1-4H2,(H,9,10)/t5-,6+,8-/m0/s1 |
| InChIKey | OGHHOBDKSSHGLW-BBVRLYRLSA-N |
| XLogP | 0.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |