C15H26O4Si — CID 18648427
(1R,2S,6S,7S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 18648427) has the molecular formula C15H26O4Si and a molecular weight of 298.45 g/mol. Its IUPAC name is (1R,2S,6S,7S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1R,2S,6S,7S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 18648427 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1R,2S,6S,7S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12CC[C@H](O1)[C@@H]1COC(=O)[C@@H]12 |
| InChI | InChI=1S/C15H26O4Si/c1-14(2,3)20(4,5)18-9-15-7-6-11(19-15)10-8-17-13(16)12(10)15/h10-12H,6-9H2,1-5H3/t10-,11-,12+,15-/m0/s1 |
| InChIKey | JVRBQUINUWVMNR-OHTBPHCPSA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|