C8H10N2O3 — CID 18648428
(1S,5R,7R)-3-nitroso-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one (PubChem CID 18648428) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is (1S,5R,7R)-3-nitroso-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one.
| Compound Name | (1S,5R,7R)-3-nitroso-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one |
|---|---|
| PubChem CID | 18648428 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (1S,5R,7R)-3-nitroso-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one |
| SMILES | O=NN1C[C@]23CC[C@H](C[C@H]2C1=O)O3 |
| InChI | InChI=1S/C8H10N2O3/c11-7-6-3-5-1-2-8(6,13-5)4-10(7)9-12/h5-6H,1-4H2/t5-,6+,8-/m1/s1 |
| InChIKey | XLAARPTWZBMQKJ-GKROBHDKSA-N |
| XLogP | 0.45 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|