C8H17NO12P2 — CID 18648597
[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] phosphono hydrogen phosphate (PubChem CID 18648597) has the molecular formula C8H17NO12P2 and a molecular weight of 381.17 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 18648597 |
| Molecular Formula | C8H17NO12P2 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | [(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] phosphono hydrogen phosphate |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H17NO12P2/c1-4(12)9-5(2-10)8(7(14)6(13)3-11)20-23(18,19)21-22(15,16)17/h2,5-8,11,13-14H,3H2,1H3,(H,9,12)(H,18,19)(H2,15,16,17)/t5-,6+,7+,8+/m0/s1 |
| InChIKey | KPCASKIJDMPPIV-LXGUWJNJSA-N |
| XLogP | -3.00 |
| TPSA | 220.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|