About 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine
5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine (PubChem CID 18648619) has the molecular formula C19H20FNO2
and a molecular weight of 313.37 g/mol. Its IUPAC name is 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine.
Molecular Properties
| Compound Name | 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine |
| PubChem CID | 18648619 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine |
| SMILES | CC/C=C/C1COC(c2ccc(-c3ccc(F)cc3)nc2)OC1 |
| InChI | InChI=1S/C19H20FNO2/c1-2-3-4-14-12-22-19(23-13-14)16-7-10-18(21-11-16)15-5-8-17(20)9-6-15/h3-11,14,19H,2,12-13H2,1H3/b4-3+ |
| InChIKey | LJHQOKJKHKZBBK-ONEGZZNKSA-N |
| XLogP | 4.52 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine?
The IUPAC name of 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine (CID 18648619) is 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine.
What is the SMILES notation for 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine?
The canonical SMILES for 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine is CC/C=C/C1COC(c2ccc(-c3ccc(F)cc3)nc2)OC1.
What is the InChIKey of 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine?
The InChIKey is LJHQOKJKHKZBBK-ONEGZZNKSA-N. The full InChI is InChI=1S/C19H20FNO2/c1-2-3-4-14-12-22-19(23-13-14)16-7-10-18(21-11-16)15-5-8-17(20)9-6-15/h3-11,14,19H,2,12-13H2,1H3/b4-3+.
What are the key properties of 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine?
5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine has a molecular weight of 313.37 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]-2-(4-fluorophenyl)pyridine is sourced from PubChem (CID 18648619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).