C27H40F2O5 — CID 18648700
methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 18648700) has the molecular formula C27H40F2O5 and a molecular weight of 482.61 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 18648700 |
| Molecular Formula | C27H40F2O5 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | CCCCC(F)(F)C(=O)/C=C/[C@H]1[C@H]2CC(CCCCC(=O)OC)=C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H40F2O5/c1-3-4-14-27(28,29)24(30)13-12-21-22-17-19(9-5-6-10-25(31)32-2)16-20(22)18-23(21)34-26-11-7-8-15-33-26/h12-13,16,20-23,26H,3-11,14-15,17-18H2,1-2H3/b13-12+/t20-,21-,22-,23+,26?/m0/s1 |
| InChIKey | XLXWXZUMAJQWHE-PGQBBXDDSA-N |
| XLogP | 6.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|