C26H34O10S2 — CID 18648779
(1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis-(4-methylphenyl)sulfonylethane-1,2-diol (PubChem CID 18648779) has the molecular formula C26H34O10S2 and a molecular weight of 570.68 g/mol. Its IUPAC name is (1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis-(4-methylphenyl)sulfonylethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis-(4-methylphenyl)sulfonylethane-1,2-diol |
|---|---|
| PubChem CID | 18648779 |
| Molecular Formula | C26H34O10S2 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | (1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis-(4-methylphenyl)sulfonylethane-1,2-diol |
| SMILES | Cc1ccc(S(=O)(=O)[C@@](O)([C@H]2COC(C)(C)O2)[C@](O)([C@H]2COC(C)(C)O2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H34O10S2/c1-17-7-11-19(12-8-17)37(29,30)25(27,21-15-33-23(3,4)35-21)26(28,22-16-34-24(5,6)36-22)38(31,32)20-13-9-18(2)10-14-20/h7-14,21-22,27-28H,15-16H2,1-6H3/t21-,22-,25+,26+/m1/s1 |
| InChIKey | YVEVWABLNORIMX-PWGHIRGTSA-N |
| XLogP | 2.23 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |