C17H29NO10 — CID 18649211
[(2S,3S,4S,5R)-2-[acetyl(methyl)amino]-3,5-diacetyloxy-2-hydroxy-4,6-dimethoxyhexyl] acetate (PubChem CID 18649211) has the molecular formula C17H29NO10 and a molecular weight of 407.42 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-2-[acetyl(methyl)amino]-3,5-diacetyloxy-2-hydroxy-4,6-dimethoxyhexyl] acetate.
| Compound Name | [(2S,3S,4S,5R)-2-[acetyl(methyl)amino]-3,5-diacetyloxy-2-hydroxy-4,6-dimethoxyhexyl] acetate |
|---|---|
| PubChem CID | 18649211 |
| Molecular Formula | C17H29NO10 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(2S,3S,4S,5R)-2-[acetyl(methyl)amino]-3,5-diacetyloxy-2-hydroxy-4,6-dimethoxyhexyl] acetate |
| SMILES | COC[C@@H](OC(C)=O)[C@H](OC)[C@H](OC(C)=O)[C@@](O)(COC(C)=O)N(C)C(C)=O |
| InChI | InChI=1S/C17H29NO10/c1-10(19)18(5)17(23,9-26-11(2)20)16(28-13(4)22)15(25-7)14(8-24-6)27-12(3)21/h14-16,23H,8-9H2,1-7H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | SRFMTGFYYRANGL-QZWWFDLISA-N |
| XLogP | -0.76 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|