About (2S)-1-ethoxy-N,4-dimethylpentan-2-amine
(2S)-1-ethoxy-N,4-dimethylpentan-2-amine (PubChem CID 18649582) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is (2S)-1-ethoxy-N,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-ethoxy-N,4-dimethylpentan-2-amine |
| PubChem CID | 18649582 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | (2S)-1-ethoxy-N,4-dimethylpentan-2-amine |
| SMILES | CCOC[C@H](CC(C)C)NC |
| InChI | InChI=1S/C9H21NO/c1-5-11-7-9(10-4)6-8(2)3/h8-10H,5-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | VBIDMMPBKIZHLO-VIFPVBQESA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-ethoxy-N,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-ethoxy-N,4-dimethylpentan-2-amine?
The IUPAC name of (2S)-1-ethoxy-N,4-dimethylpentan-2-amine (CID 18649582) is (2S)-1-ethoxy-N,4-dimethylpentan-2-amine.
What is the SMILES notation for (2S)-1-ethoxy-N,4-dimethylpentan-2-amine?
The canonical SMILES for (2S)-1-ethoxy-N,4-dimethylpentan-2-amine is CCOC[C@H](CC(C)C)NC.
What is the InChIKey of (2S)-1-ethoxy-N,4-dimethylpentan-2-amine?
The InChIKey is VBIDMMPBKIZHLO-VIFPVBQESA-N. The full InChI is InChI=1S/C9H21NO/c1-5-11-7-9(10-4)6-8(2)3/h8-10H,5-7H2,1-4H3/t9-/m0/s1.
What are the key properties of (2S)-1-ethoxy-N,4-dimethylpentan-2-amine?
(2S)-1-ethoxy-N,4-dimethylpentan-2-amine has a molecular weight of 159.27 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-ethoxy-N,4-dimethylpentan-2-amine is sourced from PubChem (CID 18649582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).