C30H54O2Si — CID 18649649
(2S)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methylpentan-3-ol (PubChem CID 18649649) has the molecular formula C30H54O2Si and a molecular weight of 474.85 g/mol. Its IUPAC name is (2S)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methylpentan-3-ol.
| Compound Name | (2S)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 18649649 |
| Molecular Formula | C30H54O2Si |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | (2S)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methylpentan-3-ol |
| SMILES | CC(C)C(O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O[Si](C)(C)C(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H54O2Si/c1-19(2)28(31)21(5)25-12-13-26-24-11-10-22-18-23(32-33(8,9)20(3)4)14-16-29(22,6)27(24)15-17-30(25,26)7/h10,19-21,23-28,31H,11-18H2,1-9H3/t21-,23-,24-,25+,26-,27-,28?,29-,30+/m0/s1 |
| InChIKey | ZWKAFYJGBQEZRY-QUSXOQGSSA-N |
| XLogP | 8.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|