C32H56O3Si — CID 18649652
ethyl (5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate (PubChem CID 18649652) has the molecular formula C32H56O3Si and a molecular weight of 516.88 g/mol. Its IUPAC name is ethyl (5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate.
| Compound Name | ethyl (5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate |
|---|---|
| PubChem CID | 18649652 |
| Molecular Formula | C32H56O3Si |
| Molecular Weight | 516.88 g/mol |
| Exact Mass | 516.40 |
| IUPAC Name | ethyl (5R)-5-[(3S,8S,9S,10R,13R,14S,17R)-3-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate |
| SMILES | CCOC(=O)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O[Si](C)(C)C(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H56O3Si/c1-9-34-30(33)12-10-11-23(4)27-15-16-28-26-14-13-24-21-25(35-36(7,8)22(2)3)17-19-31(24,5)29(26)18-20-32(27,28)6/h13,22-23,25-29H,9-12,14-21H2,1-8H3/t23-,25+,26+,27-,28+,29+,31+,32-/m1/s1 |
| InChIKey | SEXXACLRCIBYJP-PTHRTHQKSA-N |
| XLogP | 8.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.88 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|