About [(2S,3R)-2,3,4-trihydroxybutyl] nitrate
[(2S,3R)-2,3,4-trihydroxybutyl] nitrate (PubChem CID 18649661) has the molecular formula C4H9NO6
and a molecular weight of 167.12 g/mol. Its IUPAC name is [(2S,3R)-2,3,4-trihydroxybutyl] nitrate.
Molecular Properties
| Compound Name | [(2S,3R)-2,3,4-trihydroxybutyl] nitrate |
| PubChem CID | 18649661 |
| Molecular Formula | C4H9NO6 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | [(2S,3R)-2,3,4-trihydroxybutyl] nitrate |
| SMILES | O=[N+]([O-])OC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H9NO6/c6-1-3(7)4(8)2-11-5(9)10/h3-4,6-8H,1-2H2/t3-,4+/m1/s1 |
| InChIKey | ASWVTJQZGNGGGY-DMTCNVIQSA-N |
| XLogP | -2.09 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-2,3,4-trihydroxybutyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2,3,4-trihydroxybutyl] nitrate?
The IUPAC name of [(2S,3R)-2,3,4-trihydroxybutyl] nitrate (CID 18649661) is [(2S,3R)-2,3,4-trihydroxybutyl] nitrate.
What is the SMILES notation for [(2S,3R)-2,3,4-trihydroxybutyl] nitrate?
The canonical SMILES for [(2S,3R)-2,3,4-trihydroxybutyl] nitrate is O=[N+]([O-])OC[C@H](O)[C@H](O)CO.
What is the InChIKey of [(2S,3R)-2,3,4-trihydroxybutyl] nitrate?
The InChIKey is ASWVTJQZGNGGGY-DMTCNVIQSA-N. The full InChI is InChI=1S/C4H9NO6/c6-1-3(7)4(8)2-11-5(9)10/h3-4,6-8H,1-2H2/t3-,4+/m1/s1.
What are the key properties of [(2S,3R)-2,3,4-trihydroxybutyl] nitrate?
[(2S,3R)-2,3,4-trihydroxybutyl] nitrate has a molecular weight of 167.12 g/mol, XLogP of -2.09, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2,3,4-trihydroxybutyl] nitrate is sourced from PubChem (CID 18649661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).