C21H37OSb — CID 18649662
(1S,2R,10R,11S,15S)-4,5-diethyl-15-methyl-5-stibatetracyclo[8.7.0.02,7.011,15]heptadecan-4-ol (PubChem CID 18649662) has the molecular formula C21H37OSb and a molecular weight of 427.29 g/mol. Its IUPAC name is (1S,2R,10R,11S,15S)-4,5-diethyl-15-methyl-5-stibatetracyclo[8.7.0.02,7.011,15]heptadecan-4-ol.
| Compound Name | (1S,2R,10R,11S,15S)-4,5-diethyl-15-methyl-5-stibatetracyclo[8.7.0.02,7.011,15]heptadecan-4-ol |
|---|---|
| PubChem CID | 18649662 |
| Molecular Formula | C21H37OSb |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (1S,2R,10R,11S,15S)-4,5-diethyl-15-methyl-5-stibatetracyclo[8.7.0.02,7.011,15]heptadecan-4-ol |
| SMILES | CC[Sb]1CC2CC[C@@H]3[C@H](CC[C@]4(C)CCC[C@@H]34)[C@H]2CC1(O)CC |
| InChI | InChI=1S/C19H32O.C2H5.Sb/c1-4-14(20)12-17-13(2)7-8-16-15(17)9-11-19(3)10-5-6-18(16)19;1-2;/h13,15-18,20H,2,4-12H2,1,3H3;1H2,2H3;/t13?,15-,16+,17-,18-,19-;;/m0../s1 |
| InChIKey | CHZPFRKZCOMLTE-MDSSLCRQSA-N |
| XLogP | 5.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|