C11H21NO7 — CID 18649777
N-(2-hydroxyethyl)-N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide (PubChem CID 18649777) has the molecular formula C11H21NO7 and a molecular weight of 279.29 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide.
| Compound Name | N-(2-hydroxyethyl)-N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
|---|---|
| PubChem CID | 18649777 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(2-hydroxyethyl)-N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCO)C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H21NO7/c1-2-9(17)12(3-4-13)5-7(15)10(18)11(19)8(16)6-14/h2,7-8,10-11,13-16,18-19H,1,3-6H2/t7-,8+,10+,11-/m0/s1 |
| InChIKey | WXIQYDUOLVHHJG-URPMGSGRSA-N |
| XLogP | -3.57 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|