C15H29NO7 — CID 18649783
N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]-N-hexylprop-2-enamide (PubChem CID 18649783) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]-N-hexylprop-2-enamide.
| Compound Name | N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]-N-hexylprop-2-enamide |
|---|---|
| PubChem CID | 18649783 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]-N-hexylprop-2-enamide |
| SMILES | C=CC(=O)N(CCCCCC)C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H29NO7/c1-3-5-6-7-8-16(11(19)4-2)15(23)14(22)13(21)12(20)10(18)9-17/h4,10,12-15,17-18,20-23H,2-3,5-9H2,1H3/t10-,12-,13+,14-,15?/m1/s1 |
| InChIKey | LWYAKFNBCURSGN-GSZWNOCJSA-N |
| XLogP | -1.66 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|