C12H23NO6 — CID 18649789
N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propylprop-2-enamide (PubChem CID 18649789) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propylprop-2-enamide.
| Compound Name | N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 18649789 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propylprop-2-enamide |
| SMILES | C=CC(=O)N(CCC)C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H23NO6/c1-3-5-13(10(17)4-2)6-8(15)11(18)12(19)9(16)7-14/h4,8-9,11-12,14-16,18-19H,2-3,5-7H2,1H3/t8-,9+,11+,12-/m0/s1 |
| InChIKey | DQFKRPZQGUNRST-SPFNVWMYSA-N |
| XLogP | -2.15 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|