About 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one
2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one (PubChem CID 18649848) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one |
| PubChem CID | 18649848 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one |
| SMILES | CC1=CC([C@H]2CC=C(C)C2(C)C)CCC1=O |
| InChI | InChI=1S/C15H22O/c1-10-9-12(6-8-14(10)16)13-7-5-11(2)15(13,3)4/h5,9,12-13H,6-8H2,1-4H3/t12?,13-/m1/s1 |
| InChIKey | DOGMLTMTGQZRRL-ZGTCLIOFSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one?
The IUPAC name of 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one (CID 18649848) is 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one.
What is the SMILES notation for 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one?
The canonical SMILES for 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one is CC1=CC([C@H]2CC=C(C)C2(C)C)CCC1=O.
What is the InChIKey of 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one?
The InChIKey is DOGMLTMTGQZRRL-ZGTCLIOFSA-N. The full InChI is InChI=1S/C15H22O/c1-10-9-12(6-8-14(10)16)13-7-5-11(2)15(13,3)4/h5,9,12-13H,6-8H2,1-4H3/t12?,13-/m1/s1.
What are the key properties of 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one?
2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one has a molecular weight of 218.34 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]cyclohex-2-en-1-one is sourced from PubChem (CID 18649848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).