C20H18F20O2 — CID 18649910
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-ethylcyclohexane-1-carboxylate (PubChem CID 18649910) has the molecular formula C20H18F20O2 and a molecular weight of 670.32 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-ethylcyclohexane-1-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18649910 |
| Molecular Formula | C20H18F20O2 |
| Molecular Weight | 670.32 g/mol |
| Exact Mass | 670.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C20H18F20O2/c1-2-8-3-5-9(6-4-8)10(41)42-7-12(23,24)14(27,28)16(31,32)18(35,36)20(39,40)19(37,38)17(33,34)15(29,30)13(25,26)11(21)22/h8-9,11H,2-7H2,1H3 |
| InChIKey | YIKUOPDIEUVKAI-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.32 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|