C21H20F20O2 — CID 18649911
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-propylcyclohexane-1-carboxylate (PubChem CID 18649911) has the molecular formula C21H20F20O2 and a molecular weight of 684.35 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-propylcyclohexane-1-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18649911 |
| Molecular Formula | C21H20F20O2 |
| Molecular Weight | 684.35 g/mol |
| Exact Mass | 684.11 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C21H20F20O2/c1-2-3-9-4-6-10(7-5-9)11(42)43-8-13(24,25)15(28,29)17(32,33)19(36,37)21(40,41)20(38,39)18(34,35)16(30,31)14(26,27)12(22)23/h9-10,12H,2-8H2,1H3 |
| InChIKey | YOCQSPGCJYHLCE-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.35 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|