C25H28O5 — CID 18650097
[(2R,3R,3aR,6aS)-3-[(E)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5,6-dioxo-1,2,3,3a,4,6a-hexahydropentalen-2-yl] benzoate (PubChem CID 18650097) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(2R,3R,3aR,6aS)-3-[(E)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5,6-dioxo-1,2,3,3a,4,6a-hexahydropentalen-2-yl] benzoate.
| Compound Name | [(2R,3R,3aR,6aS)-3-[(E)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5,6-dioxo-1,2,3,3a,4,6a-hexahydropentalen-2-yl] benzoate |
|---|---|
| PubChem CID | 18650097 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [(2R,3R,3aR,6aS)-3-[(E)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5,6-dioxo-1,2,3,3a,4,6a-hexahydropentalen-2-yl] benzoate |
| SMILES | CCC#CCC(C)C(O)/C=C/[C@@H]1[C@H]2CC(=O)C(=O)[C@H]2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O5/c1-3-4-6-9-16(2)21(26)13-12-18-19-14-22(27)24(28)20(19)15-23(18)30-25(29)17-10-7-5-8-11-17/h5,7-8,10-13,16,18-21,23,26H,3,9,14-15H2,1-2H3/b13-12+/t16?,18-,19-,20+,21?,23-/m1/s1 |
| InChIKey | HFRSSEONNJEBCC-IXAVJZNFSA-N |
| XLogP | 3.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|