C26H23NO2 — CID 18650363
(2R,3R)-3-methyl-1-(9-phenyl-9H-fluoren-1-yl)-3,6-dihydro-2H-pyridine-2-carboxylic acid (PubChem CID 18650363) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is (2R,3R)-3-methyl-1-(9-phenyl-9H-fluoren-1-yl)-3,6-dihydro-2H-pyridine-2-carboxylic acid.
| Compound Name | (2R,3R)-3-methyl-1-(9-phenyl-9H-fluoren-1-yl)-3,6-dihydro-2H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 18650363 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (2R,3R)-3-methyl-1-(9-phenyl-9H-fluoren-1-yl)-3,6-dihydro-2H-pyridine-2-carboxylic acid |
| SMILES | C[C@@H]1C=CCN(c2cccc3c2C(c2ccccc2)c2ccccc2-3)[C@H]1C(=O)O |
| InChI | InChI=1S/C26H23NO2/c1-17-9-8-16-27(25(17)26(28)29)22-15-7-14-21-19-12-5-6-13-20(19)23(24(21)22)18-10-3-2-4-11-18/h2-15,17,23,25H,16H2,1H3,(H,28,29)/t17-,23?,25-/m1/s1 |
| InChIKey | AOXZKWONLFLFKX-RRGDWTORSA-N |
| XLogP | 5.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|