C21H27F13O — CID 18650478
4-(4-propylcyclohexyl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexan-1-ol (PubChem CID 18650478) has the molecular formula C21H27F13O and a molecular weight of 542.42 g/mol. Its IUPAC name is 4-(4-propylcyclohexyl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexan-1-ol.
| Compound Name | 4-(4-propylcyclohexyl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 18650478 |
| Molecular Formula | C21H27F13O |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 4-(4-propylcyclohexyl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexan-1-ol |
| SMILES | CCCC1CCC(C2CCC(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C21H27F13O/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(35,11-9-14)16(22,23)17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)34/h12-14,35H,2-11H2,1H3 |
| InChIKey | SQWHXLCVZUVAKF-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|