C22H26F6N2O8 — CID 18651109
[4-(2-aminoethyl)benzoyl] (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18651109) has the molecular formula C22H26F6N2O8 and a molecular weight of 560.44 g/mol. Its IUPAC name is [4-(2-aminoethyl)benzoyl] (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [4-(2-aminoethyl)benzoyl] (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18651109 |
| Molecular Formula | C22H26F6N2O8 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [4-(2-aminoethyl)benzoyl] (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1[C@H]2CC[C@@H]1[C@@H](C(=O)OC(=O)c1ccc(CCN)cc1)[C@@H](O)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N2O4.2C2HF3O2/c1-20-13-6-7-14(20)16(15(21)10-13)18(23)24-17(22)12-4-2-11(3-5-12)8-9-19;2*3-2(4,5)1(6)7/h2-5,13-16,21H,6-10,19H2,1H3;2*(H,6,7)/t13-,14+,15-,16+;;/m0../s1 |
| InChIKey | YVDLSEMWHSTEJN-SMLMHOKXSA-N |
| XLogP | 1.98 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|