C14H17NO3 — CID 18651250
(4S,5S)-3-acetyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-4-carbaldehyde (PubChem CID 18651250) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (4S,5S)-3-acetyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-4-carbaldehyde.
| Compound Name | (4S,5S)-3-acetyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 18651250 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (4S,5S)-3-acetyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-4-carbaldehyde |
| SMILES | CC(=O)N1[C@H](C=O)[C@H](c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C14H17NO3/c1-10(17)15-12(9-16)13(18-14(15,2)3)11-7-5-4-6-8-11/h4-9,12-13H,1-3H3/t12-,13+/m1/s1 |
| InChIKey | SCVJURAHBOGEJF-OLZOCXBDSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|