C7H5F6O2- — CID 18651610
(E)-4-(difluoromethyl)-4,5,5,5-tetrafluoro-2-methylpent-2-enoate (PubChem CID 18651610) has the molecular formula C7H5F6O2- and a molecular weight of 235.10 g/mol. Its IUPAC name is (E)-4-(difluoromethyl)-4,5,5,5-tetrafluoro-2-methylpent-2-enoate.
| Compound Name | (E)-4-(difluoromethyl)-4,5,5,5-tetrafluoro-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 18651610 |
| Molecular Formula | C7H5F6O2- |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | (E)-4-(difluoromethyl)-4,5,5,5-tetrafluoro-2-methylpent-2-enoate |
| SMILES | C/C(=C\C(F)(C(F)F)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C7H6F6O2/c1-3(4(14)15)2-6(10,5(8)9)7(11,12)13/h2,5H,1H3,(H,14,15)/p-1/b3-2+ |
| InChIKey | QGIHMUPTASZNIF-NSCUHMNNSA-M |
| XLogP | 1.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|