About 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol
2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol (PubChem CID 18651837) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol |
| PubChem CID | 18651837 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCN(C)CCO |
| InChI | InChI=1S/C15H31NO2/c1-12(2)14-6-5-13(3)11-15(14)18-10-8-16(4)7-9-17/h12-15,17H,5-11H2,1-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | UFDYDKPVTRPUHB-QLFBSQMISA-N |
| XLogP | 2.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol?
The IUPAC name of 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol (CID 18651837) is 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol.
What is the SMILES notation for 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol?
The canonical SMILES for 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol is CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCN(C)CCO.
What is the InChIKey of 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol?
The InChIKey is UFDYDKPVTRPUHB-QLFBSQMISA-N. The full InChI is InChI=1S/C15H31NO2/c1-12(2)14-6-5-13(3)11-15(14)18-10-8-16(4)7-9-17/h12-15,17H,5-11H2,1-4H3/t13-,14+,15-/m1/s1.
What are the key properties of 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol?
2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol has a molecular weight of 257.42 g/mol, XLogP of 2.39, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]ethanol is sourced from PubChem (CID 18651837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).