C20H36N2O7S — CID 18651997
(4S,5S)-5-[[(2S)-1-(decylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]-2-oxo-1,3,2-dioxathiolane-4-carboxylic acid (PubChem CID 18651997) has the molecular formula C20H36N2O7S and a molecular weight of 448.58 g/mol. Its IUPAC name is (4S,5S)-5-[[(2S)-1-(decylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]-2-oxo-1,3,2-dioxathiolane-4-carboxylic acid.
| Compound Name | (4S,5S)-5-[[(2S)-1-(decylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]-2-oxo-1,3,2-dioxathiolane-4-carboxylic acid |
|---|---|
| PubChem CID | 18651997 |
| Molecular Formula | C20H36N2O7S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (4S,5S)-5-[[(2S)-1-(decylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]-2-oxo-1,3,2-dioxathiolane-4-carboxylic acid |
| SMILES | CCCCCCCCCCNC(=O)[C@H](CC(C)C)NC(=O)[C@H]1OS(=O)O[C@@H]1C(=O)O |
| InChI | InChI=1S/C20H36N2O7S/c1-4-5-6-7-8-9-10-11-12-21-18(23)15(13-14(2)3)22-19(24)16-17(20(25)26)29-30(27)28-16/h14-17H,4-13H2,1-3H3,(H,21,23)(H,22,24)(H,25,26)/t15-,16-,17-,30?/m0/s1 |
| InChIKey | WDEINRZBEYHRRF-ZUEBXRPGSA-N |
| XLogP | 2.22 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|