C25H34O4Si — CID 18652279
methyl 2-[(1S,2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentyl]acetate (PubChem CID 18652279) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is methyl 2-[(1S,2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentyl]acetate |
|---|---|
| PubChem CID | 18652279 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | methyl 2-[(1S,2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentyl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H](O)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O4Si/c1-25(2,3)30(22-11-7-5-8-12-22,23-13-9-6-10-14-23)29-18-20-16-21(26)15-19(20)17-24(27)28-4/h5-14,19-21,26H,15-18H2,1-4H3/t19-,20-,21-/m0/s1 |
| InChIKey | GHYYLKQBXPJUJV-ACRUOGEOSA-N |
| XLogP | 3.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|