C16H24O6 — CID 18652541
(3aR,4R,5R,6aS)-4-(2-methyl-1,3-dioxolan-4-yl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 18652541) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(2-methyl-1,3-dioxolan-4-yl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-(2-methyl-1,3-dioxolan-4-yl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 18652541 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(2-methyl-1,3-dioxolan-4-yl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC1OCC([C@@H]2[C@H]3CC(=O)O[C@H]3C[C@H]2OC2CCCCO2)O1 |
| InChI | InChI=1S/C16H24O6/c1-9-19-8-13(20-9)16-10-6-14(17)21-11(10)7-12(16)22-15-4-2-3-5-18-15/h9-13,15-16H,2-8H2,1H3/t9?,10-,11-,12+,13?,15?,16+/m0/s1 |
| InChIKey | TZDRDKPFGFCYCX-RWKRMSAGSA-N |
| XLogP | 1.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |