C17H26F2O5 — CID 18652545
[(3aR,4R,5R,6aS)-4-(5,5-difluoro-4-hydroxyoctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 18652545) has the molecular formula C17H26F2O5 and a molecular weight of 348.39 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(5,5-difluoro-4-hydroxyoctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(5,5-difluoro-4-hydroxyoctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 18652545 |
| Molecular Formula | C17H26F2O5 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(5,5-difluoro-4-hydroxyoctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | CCCC(F)(F)C(O)CCC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H26F2O5/c1-3-7-17(18,19)15(21)6-4-5-11-12-8-16(22)24-14(12)9-13(11)23-10(2)20/h11-15,21H,3-9H2,1-2H3/t11-,12-,13-,14+,15?/m1/s1 |
| InChIKey | WMQCHJNHNVFTJU-ARJVPZMDSA-N |
| XLogP | 2.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |