C24H32O6 — CID 18652559
(1R,8R,12R,15S,17S,22R,23S)-12,17,22-trimethyl-5,9,14-trioxatetracyclo[13.7.1.14,8.019,23]tetracosa-18,20-diene-6,10,13-trione (PubChem CID 18652559) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (1R,8R,12R,15S,17S,22R,23S)-12,17,22-trimethyl-5,9,14-trioxatetracyclo[13.7.1.14,8.019,23]tetracosa-18,20-diene-6,10,13-trione.
| Compound Name | (1R,8R,12R,15S,17S,22R,23S)-12,17,22-trimethyl-5,9,14-trioxatetracyclo[13.7.1.14,8.019,23]tetracosa-18,20-diene-6,10,13-trione |
|---|---|
| PubChem CID | 18652559 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (1R,8R,12R,15S,17S,22R,23S)-12,17,22-trimethyl-5,9,14-trioxatetracyclo[13.7.1.14,8.019,23]tetracosa-18,20-diene-6,10,13-trione |
| SMILES | C[C@@H]1C=C2C=C[C@@H](C)[C@H]3CCC4C[C@H](CC(=O)O4)OC(=O)C[C@@H](C)C(=O)O[C@@H](C1)[C@H]23 |
| InChI | InChI=1S/C24H32O6/c1-13-8-16-5-4-14(2)19-7-6-17-11-18(12-22(26)28-17)29-21(25)10-15(3)24(27)30-20(9-13)23(16)19/h4-5,8,13-15,17-20,23H,6-7,9-12H2,1-3H3/t13-,14-,15-,17?,18-,19-,20+,23-/m1/s1 |
| InChIKey | ZVQNCUXKGIAESH-KJYNJGGGSA-N |
| XLogP | 3.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|