About 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol
4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol (PubChem CID 18653092) has the molecular formula C12H15ClO2
and a molecular weight of 226.70 g/mol. Its IUPAC name is 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol.
Molecular Properties
| Compound Name | 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol |
| PubChem CID | 18653092 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol |
| SMILES | Oc1ccc(Cl)cc1[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H15ClO2/c13-8-5-6-12(15)10(7-8)9-3-1-2-4-11(9)14/h5-7,9,11,14-15H,1-4H2/t9-,11+/m0/s1 |
| InChIKey | YXLODOZHOBGODL-GXSJLCMTSA-N |
| XLogP | 3.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol?
The IUPAC name of 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol (CID 18653092) is 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol.
What is the SMILES notation for 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol?
The canonical SMILES for 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol is Oc1ccc(Cl)cc1[C@@H]1CCCC[C@H]1O.
What is the InChIKey of 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol?
The InChIKey is YXLODOZHOBGODL-GXSJLCMTSA-N. The full InChI is InChI=1S/C12H15ClO2/c13-8-5-6-12(15)10(7-8)9-3-1-2-4-11(9)14/h5-7,9,11,14-15H,1-4H2/t9-,11+/m0/s1.
What are the key properties of 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol?
4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol has a molecular weight of 226.70 g/mol, XLogP of 3.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(1S,2R)-2-hydroxycyclohexyl]phenol is sourced from PubChem (CID 18653092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).