C13H21N3O4S2 — CID 18653608
5-[(3aS,4S,6aR)-3-[(2R)-2-amino-3-sulfanylpropanoyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid (PubChem CID 18653608) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-3-[(2R)-2-amino-3-sulfanylpropanoyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid.
| Compound Name | 5-[(3aS,4S,6aR)-3-[(2R)-2-amino-3-sulfanylpropanoyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 18653608 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-[(3aS,4S,6aR)-3-[(2R)-2-amino-3-sulfanylpropanoyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
| SMILES | N[C@@H](CS)C(=O)N1C(=O)N[C@H]2CS[C@@H](CCCCC(=O)O)[C@H]21 |
| InChI | InChI=1S/C13H21N3O4S2/c14-7(5-21)12(19)16-11-8(15-13(16)20)6-22-9(11)3-1-2-4-10(17)18/h7-9,11,21H,1-6,14H2,(H,15,20)(H,17,18)/t7-,8-,9-,11-/m0/s1 |
| InChIKey | QZXSSSUTKCWGMQ-KBIXCLLPSA-N |
| XLogP | 0.29 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|